cas: 13505-06-1 — see every product listed under this CAS number, including other names
4-Nitropyridin-3-ol, 96%, 96% (CAS 13505-06-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110CWV-100mg |
| cas | 13505-06-1 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 410.00 Pln | |
| Chemat | 250mg | 606.80 Pln | |
| Chemat | 1g | 1451.60 Pln | |
| Chemat | 5g | 3213.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
4-nitropyridin-3-ol (CAS 13505-06-1) is a chemical compound with the molecular formula C5H4N2O3 and a molecular weight of 140.10 g/mol. IUPAC name: 4-nitropyridin-3-ol. InChIKey: BVXHEFWTMMZHDG-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3 |
|---|---|
| Molecular weight | 140.10 g/mol |
| IUPAC name | 4-nitropyridin-3-ol |
| InChIKey | BVXHEFWTMMZHDG-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1[N+](=O)[O-])O |
Computed by PubChem (NCBI)