cas: 1124-33-0 — see every product listed under this CAS number, including other names
4-Nitropyridine-N-oxide (CAS 1124-33-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F013928-5G |
| cas | 1124-33-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 25g | 154.13 Pln | |
| Fluorochem | 100g | 351.98 Pln |
| delivery time | 3-4 weeks |
|---|
4-nitro-1-oxidopyridin-1-ium (CAS 1124-33-0) is a chemical compound with the molecular formula C5H4N2O3 and a molecular weight of 140.10 g/mol. IUPAC name: 4-nitro-1-oxidopyridin-1-ium. InChIKey: RXKNNAKAVAHBNK-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3 |
|---|---|
| Molecular weight | 140.10 g/mol |
| IUPAC name | 4-nitro-1-oxidopyridin-1-ium |
| InChIKey | RXKNNAKAVAHBNK-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=CC=C1[N+](=O)[O-])[O-] |
Computed by PubChem (NCBI)