cas: 6566-40-1 — see every product listed under this CAS number, including other names
4-Oxo-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid 98% (CAS 6566-40-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A474833-100mg |
| cas | 6566-40-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1193.62 Pln | |
| Ambeed | 5g | 3630.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A474833 |
4-oxo-2,3-dihydro-1H-naphthalene-2-carboxylic acid (CAS 6566-40-1) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 4-oxo-2,3-dihydro-1H-naphthalene-2-carboxylic acid. InChIKey: UYNMKOITXUEVCZ-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 4-oxo-2,3-dihydro-1H-naphthalene-2-carboxylic acid |
| InChIKey | UYNMKOITXUEVCZ-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)C2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)