cas: 785-17-1 — see every product listed under this CAS number, including other names
4-Oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid 97% (CAS 785-17-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A587922-100mg |
| cas | 785-17-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 592.88 Pln | |
| Ambeed | 250mg | 960.00 Pln | |
| Ambeed | 1g | 2478.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A587922 |
4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid (CAS 785-17-1) is a chemical compound with the molecular formula C14H16O3 and a molecular weight of 232.27 g/mol. IUPAC name: 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid. InChIKey: KTIOSKUXBNFTFX-UHFFFAOYSA-N.
| Molecular formula | C14H16O3 |
|---|---|
| Molecular weight | 232.27 g/mol |
| IUPAC name | 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid |
| InChIKey | KTIOSKUXBNFTFX-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC(=C2)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)