cas: 785-17-1 — see every product listed under this CAS number, including other names
4-Oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid, 97%, 97% (CAS 785-17-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GFKE-100mg |
| cas | 785-17-1 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 539.60 Pln | |
| Chemat | 250mg | 870.80 Pln | |
| Chemat | 1g | 2243.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid (CAS 785-17-1) is a chemical compound with the molecular formula C14H16O3 and a molecular weight of 232.27 g/mol. IUPAC name: 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid. InChIKey: KTIOSKUXBNFTFX-UHFFFAOYSA-N.
| Molecular formula | C14H16O3 |
|---|---|
| Molecular weight | 232.27 g/mol |
| IUPAC name | 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid |
| InChIKey | KTIOSKUXBNFTFX-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC(=C2)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)