cas: 583-06-2 — see every product listed under this CAS number, including other names
4-Oxo-4-phenylbut-2-enoic acid, 96% (CAS 583-06-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F567594-5G |
| cas | 583-06-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 174.96 Pln | |
| Fluorochem | 10g | 294.71 Pln | |
| Fluorochem | 25g | 591.48 Pln | |
| Fluorochem | 100g | 1825.42 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
(E)-4-oxo-4-phenylbut-2-enoic acid (CAS 583-06-2) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: (E)-4-oxo-4-phenylbut-2-enoic acid. InChIKey: PLPDHGOODMBBGN-VOTSOKGWSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | (E)-4-oxo-4-phenylbut-2-enoic acid |
| InChIKey | PLPDHGOODMBBGN-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)