cas: 49763-65-7 — see every product listed under this CAS number, including other names
4-Pentylbenzoyl Chloride, >98.0%(GC)(T) (CAS 49763-65-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P3076-5G |
| cas | 49763-65-7 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 483.71 Pln | |
| TCI | 25g | 1624.51 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
4-pentylbenzoyl chloride (CAS 49763-65-7) is a chemical compound with the molecular formula C12H15ClO and a molecular weight of 210.70 g/mol. IUPAC name: 4-pentylbenzoyl chloride. InChIKey: FBBRKYLXMNQFQU-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO |
|---|---|
| Molecular weight | 210.70 g/mol |
| IUPAC name | 4-pentylbenzoyl chloride |
| InChIKey | FBBRKYLXMNQFQU-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC=C(C=C1)C(=O)Cl |
Computed by PubChem (NCBI)