Products 60851-32-3
CAS 60851-32-3 appears in our catalog under these names: 1-(4-Chlorophenyl)-3,3-dimethyl-1-butanone, 95-<97%, 1-(4-Chlorophenyl)-3,3-dimethyl-1-butanone, ≥97-<99%, 1-(4-Chlorophenyl)-3,3-dimethylbutan-1-one. Offered by: Hoffman Fine Chemicals, Biosynth. Available pack sizes: 2,5g, 5g, 10g, 25g, 1g, 100mg.
1-(4-chlorophenyl)-3,3-dimethylbutan-1-one (CAS 60851-32-3) is a chemical compound with the molecular formula C12H15ClO and a molecular weight of 210.70 g/mol. IUPAC name: 1-(4-chlorophenyl)-3,3-dimethylbutan-1-one. InChIKey: USBFSVPPZZVYBP-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO |
|---|---|
| Molecular weight | 210.70 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3,3-dimethylbutan-1-one |
| InChIKey | USBFSVPPZZVYBP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)