CAS 1339409-56-1 is the registry number for 1-(4-Chlorophenyl)-2,3-dimethyl-1-butanone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
1-(4-chlorophenyl)-2,3-dimethylbutan-1-one (CAS 1339409-56-1) is a chemical compound with the molecular formula C12H15ClO and a molecular weight of 210.70 g/mol. IUPAC name: 1-(4-chlorophenyl)-2,3-dimethylbutan-1-one. InChIKey: GIRDYJRQZQMRSW-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO |
|---|---|
| Molecular weight | 210.70 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2,3-dimethylbutan-1-one |
| InChIKey | GIRDYJRQZQMRSW-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)C(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)