Products 1339409-56-1

CAS 1339409-56-1 is the registry number for 1-(4-Chlorophenyl)-2,3-dimethyl-1-butanone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-(4-chlorophenyl)-2,3-dimethylbutan-1-one (CAS 1339409-56-1) is a chemical compound with the molecular formula C12H15ClO and a molecular weight of 210.70 g/mol. IUPAC name: 1-(4-chlorophenyl)-2,3-dimethylbutan-1-one. InChIKey: GIRDYJRQZQMRSW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15ClO
Molecular weight210.70 g/mol
IUPAC name1-(4-chlorophenyl)-2,3-dimethylbutan-1-one
InChIKeyGIRDYJRQZQMRSW-UHFFFAOYSA-N
SMILESCC(C)C(C)C(=O)C1=CC=C(C=C1)Cl

Computed by PubChem (NCBI)