cas: 1227587-24-7 — see every product listed under this CAS number, including other names
4-Pyridinecarboxylic acid, 2-chloro-3-(trifluoromethyl)-, 97%, 97% (CAS 1227587-24-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111JDM-100mg |
| cas | 1227587-24-7 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 491.60 Pln | |
| Chemat | 250mg | 923.60 Pln | |
| Chemat | 500mg | 1499.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-chloro-3-(trifluoromethyl)pyridine-4-carboxylic acid (CAS 1227587-24-7) is a chemical compound with the molecular formula C7H3ClF3NO2 and a molecular weight of 225.55 g/mol. IUPAC name: 2-chloro-3-(trifluoromethyl)pyridine-4-carboxylic acid. InChIKey: DIPOFUPESWIQSO-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO2 |
|---|---|
| Molecular weight | 225.55 g/mol |
| IUPAC name | 2-chloro-3-(trifluoromethyl)pyridine-4-carboxylic acid |
| InChIKey | DIPOFUPESWIQSO-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(=O)O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)