cas: 68373-14-8 — see every product listed under this CAS number, including other names
4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-, 4,4-dioxide, (2S-cis)-, 98%, 98% (CAS 68373-14-8) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 5kg, 10kg, 25kg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IBTX-1kg |
| cas | 68373-14-8 |
| size | 1kg |
| availability | 25000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 3074.00 Pln | |
| Chemat | 5kg | 6739.20 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 25kg | price on request | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 25g | 165.20 Pln | |
| Chemat | 100g | 448.40 Pln | |
| Chemat | 500g | 1833.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Sulbactam is a member of penicillanic acids. It is a conjugate acid of a sulbactam(1-).
Source: ChEBI
| Molecular formula | C8H11NO5S |
|---|---|
| Molecular weight | 233.24 g/mol |
| IUPAC name | (2S,5R)-3,3-dimethyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChIKey | FKENQMMABCRJMK-RITPCOANSA-N |
| SMILES | CC1([C@@H](N2[C@H](S1(=O)=O)CC2=O)C(=O)O)C |
Computed by PubChem (NCBI)