cas: 5580-20-1 — see every product listed under this CAS number, including other names
4-Thio-2’-deoxyuridine, 99.78% (CAS 5580-20-1) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 5 mg, 50 mg, 100 mg, 10 mg, 25 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W251781-10mM/1mL |
| cas | 5580-20-1 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 779.45 Pln | |
| MedChemExpress | 5 mg | 245.39 Pln | |
| MedChemExpress | 50 mg | 719.08 Pln | |
| MedChemExpress | 100 mg | 1127.75 Pln | |
| MedChemExpress | 10 mg | 310.40 Pln | |
| MedChemExpress | 25 mg | 496.16 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.78% |
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one (CAS 5580-20-1) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one. InChIKey: PHNDUXLWAVSUAL-SHYZEUOFSA-N.
| Molecular formula | C9H12N2O4S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one |
| InChIKey | PHNDUXLWAVSUAL-SHYZEUOFSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=CC(=S)NC2=O)CO)O |
Computed by PubChem (NCBI)