cas: 7236-57-9 — see every product listed under this CAS number, including other names
4-Thiothymidine 95% (CAS 7236-57-9) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A836841-25mg |
| cas | 7236-57-9 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 248.00 Pln | |
| Ambeed | 50mg | 331.44 Pln | |
| Ambeed | 100mg | 437.12 Pln | |
| Ambeed | 250mg | 865.44 Pln | |
| Ambeed | 1g | 2222.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A836841 |
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one (CAS 7236-57-9) is a chemical compound with the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one. InChIKey: AVKSPBJBGGHUMW-XLPZGREQSA-N.
| Molecular formula | C10H14N2O4S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one |
| InChIKey | AVKSPBJBGGHUMW-XLPZGREQSA-N |
| SMILES | CC1=CN(C(=O)NC1=S)[C@H]2C[C@@H]([C@H](O2)CO)O |
Computed by PubChem (NCBI)