cas: 6339-26-0 — see every product listed under this CAS number, including other names
4-Tosylmorpholine 95% (CAS 6339-26-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A653871-250mg |
| cas | 6339-26-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1588.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A653871 |
4-(4-methylphenyl)sulfonylmorpholine (CAS 6339-26-0) is a chemical compound with the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. IUPAC name: 4-(4-methylphenyl)sulfonylmorpholine. InChIKey: NBTTYMBZXDHFCP-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | 4-(4-methylphenyl)sulfonylmorpholine |
| InChIKey | NBTTYMBZXDHFCP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCOCC2 |
Computed by PubChem (NCBI)