CAS 6339-26-0 appears in our catalog under these names: 4-[(4-Methylbenzene)sulfonyl]morpholine, 95%, 4-Tosylmorpholine, 95-<97%, 4–Tosylmorpholine, 4-Tosylmorpholine, 97%, 97%, 4-tosylmorpholine, 95+%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 50g, 100g, 200g, 300g.
4-(4-methylphenyl)sulfonylmorpholine (CAS 6339-26-0) is a chemical compound with the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. IUPAC name: 4-(4-methylphenyl)sulfonylmorpholine. InChIKey: NBTTYMBZXDHFCP-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | 4-(4-methylphenyl)sulfonylmorpholine |
| InChIKey | NBTTYMBZXDHFCP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCOCC2 |
Computed by PubChem (NCBI)