CAS 634593-20-7 is the registry number for 2-[(2,2-Dimethylpropanoyl)amino]-5-methyl-3-thiophenecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(2,2-dimethylpropanoylamino)-5-methylthiophene-3-carboxylic acid (CAS 634593-20-7) is a chemical compound with the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. IUPAC name: 2-(2,2-dimethylpropanoylamino)-5-methylthiophene-3-carboxylic acid. InChIKey: QGGGLFAQLJKYKA-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | 2-(2,2-dimethylpropanoylamino)-5-methylthiophene-3-carboxylic acid |
| InChIKey | QGGGLFAQLJKYKA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(S1)NC(=O)C(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)