CAS 713111-73-0 is the registry number for Methyl 2-amino-5,5-dimethyl-4,7-dihydro-5h-thieno[2,3-c]pyran-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2-amino-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyran-3-carboxylate (CAS 713111-73-0) is a chemical compound with the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. IUPAC name: methyl 2-amino-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyran-3-carboxylate. InChIKey: SVGGVCOTTKLQGH-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | methyl 2-amino-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyran-3-carboxylate |
| InChIKey | SVGGVCOTTKLQGH-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(CO1)SC(=C2C(=O)OC)N)C |
Computed by PubChem (NCBI)