CAS 923249-03-0 appears in our catalog under these names: 5-[(2,2-Dimethylpropanoyl)amino]-3-methylthiophene-2-carboxylic acid, 95%, 5-(2,2-Dimethylpropanamido)-3-methylthiophene-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carboxylic acid (CAS 923249-03-0) is a chemical compound with the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. IUPAC name: 5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carboxylic acid. InChIKey: QLYPBEHDVISVBV-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | 5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carboxylic acid |
| InChIKey | QLYPBEHDVISVBV-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1)NC(=O)C(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)