CAS 303992-20-3 appears in our catalog under these names: 3-((4-Methoxyphenyl)amino)tetrahydrothiophene 1,1-dioxide, 98%, 3-[(4-Methoxyphenyl)amino]-1lambda(6)-thiolane-1,1-dione, 95%, Tetrahydro-​N-​(4-​methoxyphenyl)​-3-​thiophenamine 1,​1-​dioxide. Offered by: AmBeed, Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg, 0,5g.
N-(4-methoxyphenyl)-1,1-dioxothiolan-3-amine (CAS 303992-20-3) is a chemical compound with the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. IUPAC name: N-(4-methoxyphenyl)-1,1-dioxothiolan-3-amine. InChIKey: JWARIOINZRSQPD-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | N-(4-methoxyphenyl)-1,1-dioxothiolan-3-amine |
| InChIKey | JWARIOINZRSQPD-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC2CCS(=O)(=O)C2 |
Computed by PubChem (NCBI)