cas: 1691774-44-3 — see every product listed under this CAS number, including other names
4-bromo-1-methyl-2-(2,2,2-trifluoroethoxy)benzene, 95%, 95% (CAS 1691774-44-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12NVOJ-100mg |
| cas | 1691774-44-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 880.40 Pln | |
| Chemat | 250mg | 1427.60 Pln | |
| Chemat | 1g | 2339.60 Pln | |
| Chemat | 5g | 6904.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-bromo-1-methyl-2-(2,2,2-trifluoroethoxy)benzene (CAS 1691774-44-3) is a chemical compound with the molecular formula C9H8BrF3O and a molecular weight of 269.06 g/mol. IUPAC name: 4-bromo-1-methyl-2-(2,2,2-trifluoroethoxy)benzene. InChIKey: DKRAASDBGUIHMT-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O |
|---|---|
| Molecular weight | 269.06 g/mol |
| IUPAC name | 4-bromo-1-methyl-2-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | DKRAASDBGUIHMT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Br)OCC(F)(F)F |
Computed by PubChem (NCBI)