cas: 23886-71-7 — see every product listed under this CAS number, including other names
4-methoxy-4'-methylbenzophenone (CAS 23886-71-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F201576-5G |
| cas | 23886-71-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 6099.95 Pln | |
| Fluorochem | 250mg | 883.04 Pln | |
| Fluorochem | 1g | 2481.44 Pln |
| delivery time | 3-4 weeks |
|---|
(4-methoxyphenyl)-(4-methylphenyl)methanone (CAS 23886-71-7) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: (4-methoxyphenyl)-(4-methylphenyl)methanone. InChIKey: IHMWJDNMIIEDDN-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | (4-methoxyphenyl)-(4-methylphenyl)methanone |
| InChIKey | IHMWJDNMIIEDDN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)