cas: 59528-30-2 — see every product listed under this CAS number, including other names
4-tert-Butylbenzylamine hydrochloride (CAS 59528-30-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F494235-250MG |
| cas | 59528-30-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 445.69 Pln | |
| Fluorochem | 10g | 627.92 Pln | |
| Fluorochem | 25g | 1070.47 Pln | |
| Fluorochem | 100g | 3168.69 Pln |
| delivery time | 3-4 weeks |
|---|
(4-tert-butylphenyl)methanamine;hydrochloride (CAS 59528-30-2) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: (4-tert-butylphenyl)methanamine;hydrochloride. InChIKey: MARHPSYFKRETIW-UHFFFAOYSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | (4-tert-butylphenyl)methanamine;hydrochloride |
| InChIKey | MARHPSYFKRETIW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)