CAS 93363-11-2 appears in our catalog under these names: 48740 RP/ 99.4% (existing batch purity), 48740 RP (RP–55778), 48740 RP. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg.
3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide (CAS 93363-11-2) is a chemical compound with the molecular formula C12H11N3OS and a molecular weight of 245.30 g/mol. IUPAC name: 3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide. InChIKey: ARFOASMERCHFBY-UHFFFAOYSA-N.
| Molecular formula | C12H11N3OS |
|---|---|
| Molecular weight | 245.30 g/mol |
| IUPAC name | 3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide |
| InChIKey | ARFOASMERCHFBY-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CN2C(S1)C3=CN=CC=C3)C(=O)N |
Computed by PubChem (NCBI)