5,5'-Dichloro-[1,1'-biphenyl]-2,2'-diamine, 95+%
cas: 2849-36-7 — see every product listed under this CAS number, including other names
5,5'-Dichloro-[1,1'-biphenyl]-2,2'-diamine, 95+% (CAS 2849-36-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1867642-100mg |
| cas | 2849-36-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 342.56 Pln | |
| Ambeed | 250mg | 553.94 Pln | |
| Ambeed | 1g | 1282.62 Pln | |
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 1g | 923.60 Pln | |
| BLDpharm | 100mg | 331.02 Pln | |
| BLDpharm | 250mg | 542.06 Pln | |
| BLDpharm | 1g | 1258.47 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
2-(2-amino-5-chlorophenyl)-4-chloroaniline (CAS 2849-36-7) is a chemical compound with the molecular formula C12H10Cl2N2 and a molecular weight of 253.12 g/mol. IUPAC name: 2-(2-amino-5-chlorophenyl)-4-chloroaniline. InChIKey: WAHUPQHLDYRCLC-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | 2-(2-amino-5-chlorophenyl)-4-chloroaniline |
| InChIKey | WAHUPQHLDYRCLC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C2=C(C=CC(=C2)Cl)N)N |
Computed by PubChem (NCBI)