CAS 84-68-4 appears in our catalog under these names: 2,2'-Dichloro-1,1'-biphenyl-4,4'-diamine, 95%, 4,4’–Diamino–2,2’–dichlorobiphenyl, 2,2'-Dichloro-1,1'-biphenyl-4,4'-diamine, 4,4'-Diamino-2,2'-dichlorobiphenyl, >97%, >97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 500mg, 1000mg, 2000mg, 5000mg.
4-(4-amino-2-chlorophenyl)-3-chloroaniline (CAS 84-68-4) is a chemical compound with the molecular formula C12H10Cl2N2 and a molecular weight of 253.12 g/mol. IUPAC name: 4-(4-amino-2-chlorophenyl)-3-chloroaniline. InChIKey: XKXPBJBODVHDAW-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | 4-(4-amino-2-chlorophenyl)-3-chloroaniline |
| InChIKey | XKXPBJBODVHDAW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)Cl)C2=C(C=C(C=C2)N)Cl |
Computed by PubChem (NCBI)