CAS 939755-75-6 is the registry number for N-(2,4-Dichlorobenzyl)pyridin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(2,4-dichlorophenyl)methyl]pyridin-3-amine (CAS 939755-75-6) is a chemical compound with the molecular formula C12H10Cl2N2 and a molecular weight of 253.12 g/mol. IUPAC name: N-[(2,4-dichlorophenyl)methyl]pyridin-3-amine. InChIKey: VLTPTNYESAZLJO-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | N-[(2,4-dichlorophenyl)methyl]pyridin-3-amine |
| InChIKey | VLTPTNYESAZLJO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)NCC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)