CAS 138219-98-4 appears in our catalog under these names: 4,4'-Bis(chloromethyl)-2,2'-bipyridine 98%, 4,4'-Bis(chloromethyl)-2,2'-bipyridyl, 95%, 4,4'-Bis(chloromethyl)-2,2'-bipyridyl, >98.0%(T), 4,4'-Bis(chloromethyl)-2,2'-bipyridine, 95%, 95%, 4,4'-Bis(chloromethyl)-2,2'-bipyridine. Offered by: Ambeed, Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
4-(chloromethyl)-2-[4-(chloromethyl)-2-pyridinyl]pyridine (CAS 138219-98-4) is a chemical compound with the molecular formula C12H10Cl2N2 and a molecular weight of 253.12 g/mol. IUPAC name: 4-(chloromethyl)-2-[4-(chloromethyl)-2-pyridinyl]pyridine. InChIKey: VZKSOWFFOHQARA-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | 4-(chloromethyl)-2-[4-(chloromethyl)-2-pyridinyl]pyridine |
| InChIKey | VZKSOWFFOHQARA-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1CCl)C2=NC=CC(=C2)CCl |
Computed by PubChem (NCBI)