Products 74065-64-8
CAS 74065-64-8 appears in our catalog under these names: 6,6'-Bis(chloromethyl)-2,2'-bipyridine, 95%, 6,6'-Bis(chloromethyl)-2,2'-bipyridine, 98%, 6,6'-Bis(chloromethyl)-2,2'-bipyridyl, >98.0%(GC)(T), 6,6'-Bis(chloromethyl)-2,2'-bipyridine, 98.0%, 98.0%, 6,6'-BIS(CHLOROMETHYL)-2,2'-BIPYRIDYL, ≥98%. Offered by: Combi-blocks, AmBeed, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 200mg.
2-(chloromethyl)-6-[6-(chloromethyl)-2-pyridinyl]pyridine (CAS 74065-64-8) is a chemical compound with the molecular formula C12H10Cl2N2 and a molecular weight of 253.12 g/mol. IUPAC name: 2-(chloromethyl)-6-[6-(chloromethyl)-2-pyridinyl]pyridine. InChIKey: CUWSIBMCPYEBPL-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | 2-(chloromethyl)-6-[6-(chloromethyl)-2-pyridinyl]pyridine |
| InChIKey | CUWSIBMCPYEBPL-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C2=CC=CC(=N2)CCl)CCl |
Computed by PubChem (NCBI)