CAS 953-14-0 appears in our catalog under these names: N,N'-Bis-(4-chloro-phenyl)-hydrazine, 95%, 1,2-Bis(4-chlorophenyl)hydrazine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
1,2-bis(4-chlorophenyl)hydrazine (CAS 953-14-0) is a chemical compound with the molecular formula C12H10Cl2N2 and a molecular weight of 253.12 g/mol. IUPAC name: 1,2-bis(4-chlorophenyl)hydrazine. InChIKey: BVPHWSDABGXRQD-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | 1,2-bis(4-chlorophenyl)hydrazine |
| InChIKey | BVPHWSDABGXRQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NNC2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)