Products 380427-38-3
CAS 380427-38-3 appears in our catalog under these names: 4–(Isopropylthio)benzeneboronic acid(contains varying amounts of Anhydride), 4-(Isopropylthio)phenylboronic Acid (contains varying amounts of Anhydride), 4-Isopropylthiophenylboronic acid 96%, 4-(Isopropylthio)phenylboronic acid, 96%, 96%, 4-(Isopropylthio)phenylboronic acid, 96%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 25g, 250mg.
(4-propan-2-ylsulfanylphenyl)boronic acid (CAS 380427-38-3) is a chemical compound with the molecular formula C9H13BO2S and a molecular weight of 196.08 g/mol. IUPAC name: (4-propan-2-ylsulfanylphenyl)boronic acid. InChIKey: FYJDSWBEPMIWEC-UHFFFAOYSA-N.
| Molecular formula | C9H13BO2S |
|---|---|
| Molecular weight | 196.08 g/mol |
| IUPAC name | (4-propan-2-ylsulfanylphenyl)boronic acid |
| InChIKey | FYJDSWBEPMIWEC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)SC(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(Isopropylthio)benzeneboronic acid, 4-Isopropylthiophenylboronic acid, 4-(Isopropylthio)phenylboronic acid, (4-propan-2-ylsulfanylphenyl)boronic Acid, (4-(isopropylthio)phenyl)boronic acid, [4-(isopropylthio)phenyl]boronic acid, 4-iso-Propylthiobenzeneboronic acid, 4-Isopropylthiophenylboronicacid, 4-isopropylthiophenyl boronic acid, FYJDSWBEPMIWEC-UHFFFAOYSA-N