CAS 905966-46-3 appears in our catalog under these names: 1,3,2–Dioxaborinane, 5,5–dimethyl–2–(3–thienyl)–, 5,5-Dimethyl-2-(thiophen-3-yl)-1,3,2-dioxaborinane, 5,5-Dimethyl-2-(thiophen-3-yl)-1,3,2-dioxaborinane 98%, 5,5-Dimethyl-2-(thiophen-3-yl)-1,3,2-dioxaborinane, 98%. Offered by: GLPBio, Chemat, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 25g.
5,5-dimethyl-2-thiophen-3-yl-1,3,2-dioxaborinane (CAS 905966-46-3) is a chemical compound with the molecular formula C9H13BO2S and a molecular weight of 196.08 g/mol. IUPAC name: 5,5-dimethyl-2-thiophen-3-yl-1,3,2-dioxaborinane. InChIKey: YNZTUXYWQNKVTM-UHFFFAOYSA-N.
| Molecular formula | C9H13BO2S |
|---|---|
| Molecular weight | 196.08 g/mol |
| IUPAC name | 5,5-dimethyl-2-thiophen-3-yl-1,3,2-dioxaborinane |
| InChIKey | YNZTUXYWQNKVTM-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CSC=C2 |
Computed by PubChem (NCBI)