Products 1267535-92-1

CAS 1267535-92-1 appears in our catalog under these names: 2,6-Dimethyl-4-(methylthio)phenylboronic Acid, ≥95%, ≥95%, 2,6-DIMETHYL-4-(METHYLTHIO)PHENYLBORONIC ACID, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(2,6-dimethyl-4-methylsulfanylphenyl)boronic acid (CAS 1267535-92-1) is a chemical compound with the molecular formula C9H13BO2S and a molecular weight of 196.08 g/mol. IUPAC name: (2,6-dimethyl-4-methylsulfanylphenyl)boronic acid. InChIKey: ZVEOWAXMICJJSX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13BO2S
Molecular weight196.08 g/mol
IUPAC name(2,6-dimethyl-4-methylsulfanylphenyl)boronic acid
InChIKeyZVEOWAXMICJJSX-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1C)SC)C)(O)O

Computed by PubChem (NCBI)