CAS 1115024-63-9 is the registry number for (3-Ethyl-5-(methylthio)phenyl)boronic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
(3-ethyl-5-methylsulfanylphenyl)boronic acid (CAS 1115024-63-9) is a chemical compound with the molecular formula C9H13BO2S and a molecular weight of 196.08 g/mol. IUPAC name: (3-ethyl-5-methylsulfanylphenyl)boronic acid. InChIKey: MZGLBGUQFHKGBQ-UHFFFAOYSA-N.
| Molecular formula | C9H13BO2S |
|---|---|
| Molecular weight | 196.08 g/mol |
| IUPAC name | (3-ethyl-5-methylsulfanylphenyl)boronic acid |
| InChIKey | MZGLBGUQFHKGBQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)SC)CC)(O)O |
Computed by PubChem (NCBI)