cas: 14346-24-8 — see every product listed under this CAS number, including other names
5,6,7,8-Tetrahydro[1]benzothieno[2,3-d]pyrimidin-4(1H)-one, 98%, 98% (CAS 14346-24-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g, 25g, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117UZN-100mg |
| cas | 14346-24-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 5g | 650.00 Pln | |
| Chemat | 25g | 2104.40 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 251.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (CAS 14346-24-8) is a chemical compound with the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. IUPAC name: 5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one. InChIKey: NMMOEJUJKIXUQZ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2OS |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| InChIKey | NMMOEJUJKIXUQZ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(S2)N=CNC3=O |
Computed by PubChem (NCBI)