cas: 14346-24-8 — see every product listed under this CAS number, including other names
8-thia-4,6-diazatricyclo[7.4.0.0²,â·]trideca-1(9),2(7),5-trien-3-one, 98% (CAS 14346-24-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F979874-1G |
| cas | 14346-24-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 768.50 Pln | |
| Fluorochem | 10g | 1372.45 Pln | |
| Fluorochem | 25g | 2569.95 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (CAS 14346-24-8) is a chemical compound with the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. IUPAC name: 5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one. InChIKey: NMMOEJUJKIXUQZ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2OS |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| InChIKey | NMMOEJUJKIXUQZ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(S2)N=CNC3=O |
Computed by PubChem (NCBI)