cas: 716320-92-2 — see every product listed under this CAS number, including other names
5,6-Dibromo-1H-Benzo[d][1,2,3]Triazole, 97%, 97% (CAS 716320-92-2) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DIMJ-25mg |
| cas | 716320-92-2 |
| size | 25mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 83.60 Pln | |
| Chemat | 50mg | 93.20 Pln | |
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 434.00 Pln | |
| Chemat | 5g | 1859.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5,6-dibromo-2H-benzotriazole (CAS 716320-92-2) is a chemical compound with the molecular formula C6H3Br2N3 and a molecular weight of 276.92 g/mol. IUPAC name: 5,6-dibromo-2H-benzotriazole. InChIKey: DULRVLLMOREPRG-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2N3 |
|---|---|
| Molecular weight | 276.92 g/mol |
| IUPAC name | 5,6-dibromo-2H-benzotriazole |
| InChIKey | DULRVLLMOREPRG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=NNN=C21)Br)Br |
Computed by PubChem (NCBI)