CAS 1357945-30-2 is the registry number for 3,4-Dibromo-1h-pyrazolo[4,3-c]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3,4-dibromo-2H-pyrazolo[4,3-c]pyridine (CAS 1357945-30-2) is a chemical compound with the molecular formula C6H3Br2N3 and a molecular weight of 276.92 g/mol. IUPAC name: 3,4-dibromo-2H-pyrazolo[4,3-c]pyridine. InChIKey: LQKRJJHFVCFTHM-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2N3 |
|---|---|
| Molecular weight | 276.92 g/mol |
| IUPAC name | 3,4-dibromo-2H-pyrazolo[4,3-c]pyridine |
| InChIKey | LQKRJJHFVCFTHM-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=C(NN=C21)Br)Br |
Computed by PubChem (NCBI)