CAS 1245647-43-1 appears in our catalog under these names: 3,6-Dibromo-imidazo[1,2-a]pyrazine, 95%, 3,6-Dibromoimidazo[1,2-a]pyrazine 97%, 3,6-Dibromo-imidazo[1,2-a]pyrazine, 97%, 97%, 3,6-Dibromoimidazo[1,2-a]pyrazine, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg.
3,6-dibromoimidazo[1,2-a]pyrazine (CAS 1245647-43-1) is a chemical compound with the molecular formula C6H3Br2N3 and a molecular weight of 276.92 g/mol. IUPAC name: 3,6-dibromoimidazo[1,2-a]pyrazine. InChIKey: DJFWUZOUSWZZGS-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2N3 |
|---|---|
| Molecular weight | 276.92 g/mol |
| IUPAC name | 3,6-dibromoimidazo[1,2-a]pyrazine |
| InChIKey | DJFWUZOUSWZZGS-UHFFFAOYSA-N |
| SMILES | C1=C(N2C=C(N=CC2=N1)Br)Br |
Computed by PubChem (NCBI)