Products 716320-92-2
CAS 716320-92-2 appears in our catalog under these names: 5,6-Dibromo-1h-benzotriazole, 95%, 5,6-Dibromo-1H-benzo(d)(1,2,3)triazole, 95%, 5，6–Dibromo–1H–benzo(d)(1，2，3)triazole, 5,6-Dibromo-1H-benzotriazole, 5,6-Dibromo-1H-benzo[d][1,2,3]triazole 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 100mg, 2,5g, 25mg, 50mg, 5g.
5,6-dibromo-2H-benzotriazole (CAS 716320-92-2) is a chemical compound with the molecular formula C6H3Br2N3 and a molecular weight of 276.92 g/mol. IUPAC name: 5,6-dibromo-2H-benzotriazole. InChIKey: DULRVLLMOREPRG-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2N3 |
|---|---|
| Molecular weight | 276.92 g/mol |
| IUPAC name | 5,6-dibromo-2H-benzotriazole |
| InChIKey | DULRVLLMOREPRG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=NNN=C21)Br)Br |
Computed by PubChem (NCBI)