Products 1380331-15-6
CAS 1380331-15-6 appears in our catalog under these names: 2,7-Dibromo-[1,2,4]triazolo[1,5-a]pyridine, 95%, 2,7-Dibromo-(1,2,4)triazolo(1,5-a)pyridine, 98%, 2,7-Dibromo-[1,2,4]triazolo[1,5-a]pyridine, 98%, 98%, 2,7-DIBROMO-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 50mg, 100mg.
2,7-dibromo-[1,2,4]triazolo[1,5-a]pyridine (CAS 1380331-15-6) is a chemical compound with the molecular formula C6H3Br2N3 and a molecular weight of 276.92 g/mol. IUPAC name: 2,7-dibromo-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: NCONOGCFMPPUSQ-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2N3 |
|---|---|
| Molecular weight | 276.92 g/mol |
| IUPAC name | 2,7-dibromo-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | NCONOGCFMPPUSQ-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)Br)C=C1Br |
Computed by PubChem (NCBI)