CAS 1257705-07-9 is the registry number for 2,8-Dibromo-[1,2,4]triazolo[1,5-a]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,8-dibromo-[1,2,4]triazolo[1,5-a]pyridine (CAS 1257705-07-9) is a chemical compound with the molecular formula C6H3Br2N3 and a molecular weight of 276.92 g/mol. IUPAC name: 2,8-dibromo-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: LSTOPRBLSYPTFQ-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2N3 |
|---|---|
| Molecular weight | 276.92 g/mol |
| IUPAC name | 2,8-dibromo-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | LSTOPRBLSYPTFQ-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)Br)C(=C1)Br |
Computed by PubChem (NCBI)