5,6-Difluorobenzofuran-2-carboxylic acid, 95%
cas: 199287-53-1 — see every product listed under this CAS number, including other names
5,6-Difluorobenzofuran-2-carboxylic acid, 95% (CAS 199287-53-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1132071-250mg |
| cas | 199287-53-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1766.56 Pln | |
| Ambeed | 1g | 4631.25 Pln | |
| Chemat | 50mg | 606.80 Pln | |
| Chemat | 100mg | 981.20 Pln | |
| Chemat | 250mg | 1624.40 Pln | |
| Chemat | 1g | 4278.80 Pln | |
| BLDpharm | 50mg | 647.57 Pln | |
| BLDpharm | 100mg | 1052.99 Pln | |
| BLDpharm | 250mg | 1736.08 Pln | |
| BLDpharm | 1g | 4540.65 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
5,6-difluoro-1-benzofuran-2-carboxylic acid (CAS 199287-53-1) is a chemical compound with the molecular formula C9H4F2O3 and a molecular weight of 198.12 g/mol. IUPAC name: 5,6-difluoro-1-benzofuran-2-carboxylic acid. InChIKey: OWFRWTPPOZSWLL-UHFFFAOYSA-N.
| Molecular formula | C9H4F2O3 |
|---|---|
| Molecular weight | 198.12 g/mol |
| IUPAC name | 5,6-difluoro-1-benzofuran-2-carboxylic acid |
| InChIKey | OWFRWTPPOZSWLL-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(OC2=CC(=C1F)F)C(=O)O |
Computed by PubChem (NCBI)