Products 1504512-59-7

CAS 1504512-59-7 appears in our catalog under these names: 5,7-Difluoro-1-benzofuran-3-carboxylic acid, 97%, 5,7-Difluoro-1-benzofuran-3-carboxylic acid, 5,7-Difluoro-1-benzofuran-3-carboxylic acid, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 250mg, 1g, 500mg, 2.5g.

5,7-difluoro-1-benzofuran-3-carboxylic acid (CAS 1504512-59-7) is a chemical compound with the molecular formula C9H4F2O3 and a molecular weight of 198.12 g/mol. IUPAC name: 5,7-difluoro-1-benzofuran-3-carboxylic acid. InChIKey: OTPQOPLHCGEGSD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H4F2O3
Molecular weight198.12 g/mol
IUPAC name5,7-difluoro-1-benzofuran-3-carboxylic acid
InChIKeyOTPQOPLHCGEGSD-UHFFFAOYSA-N
SMILESC1=C(C=C(C2=C1C(=CO2)C(=O)O)F)F

Computed by PubChem (NCBI)