Products 1517807-37-2
CAS 1517807-37-2 appears in our catalog under these names: 4,6-Difluoro-1-benzofuran-3-carboxylic acid, 95%, 4,6-Difluoro-1-benzofuran-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4,6-difluoro-1-benzofuran-3-carboxylic acid (CAS 1517807-37-2) is a chemical compound with the molecular formula C9H4F2O3 and a molecular weight of 198.12 g/mol. IUPAC name: 4,6-difluoro-1-benzofuran-3-carboxylic acid. InChIKey: XWMSJXUGUIOQMY-UHFFFAOYSA-N.
| Molecular formula | C9H4F2O3 |
|---|---|
| Molecular weight | 198.12 g/mol |
| IUPAC name | 4,6-difluoro-1-benzofuran-3-carboxylic acid |
| InChIKey | XWMSJXUGUIOQMY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1OC=C2C(=O)O)F)F |
Computed by PubChem (NCBI)