CAS 1784077-42-4 appears in our catalog under these names: 6,7-Difluoro-1-benzofuran-2-carboxylic acid, 95%, 6,7-Difluoro-1-benzofuran-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6,7-difluoro-1-benzofuran-2-carboxylic acid (CAS 1784077-42-4) is a chemical compound with the molecular formula C9H4F2O3 and a molecular weight of 198.12 g/mol. IUPAC name: 6,7-difluoro-1-benzofuran-2-carboxylic acid. InChIKey: XRLRTKXVZAXYTR-UHFFFAOYSA-N.
| Molecular formula | C9H4F2O3 |
|---|---|
| Molecular weight | 198.12 g/mol |
| IUPAC name | 6,7-difluoro-1-benzofuran-2-carboxylic acid |
| InChIKey | XRLRTKXVZAXYTR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=C(O2)C(=O)O)F)F |
Computed by PubChem (NCBI)