Products 1935101-74-8
CAS 1935101-74-8 appears in our catalog under these names: 4,5-Difluoro-1-benzofuran-7-carboxylic acid, 95%, 4,5-Difluorobenzofuran-7-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
4,5-difluoro-1-benzofuran-7-carboxylic acid (CAS 1935101-74-8) is a chemical compound with the molecular formula C9H4F2O3 and a molecular weight of 198.12 g/mol. IUPAC name: 4,5-difluoro-1-benzofuran-7-carboxylic acid. InChIKey: KCMHRKBZNKAAAY-UHFFFAOYSA-N.
| Molecular formula | C9H4F2O3 |
|---|---|
| Molecular weight | 198.12 g/mol |
| IUPAC name | 4,5-difluoro-1-benzofuran-7-carboxylic acid |
| InChIKey | KCMHRKBZNKAAAY-UHFFFAOYSA-N |
| SMILES | C1=COC2=C1C(=C(C=C2C(=O)O)F)F |
Computed by PubChem (NCBI)