Products 199287-53-1
CAS 199287-53-1 appears in our catalog under these names: 5,6-Difluorobenzofuran-2-carboxylic acid, 95%, 95%, 5,6-Difluorobenzofuran-2-carboxylic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
5,6-difluoro-1-benzofuran-2-carboxylic acid (CAS 199287-53-1) is a chemical compound with the molecular formula C9H4F2O3 and a molecular weight of 198.12 g/mol. IUPAC name: 5,6-difluoro-1-benzofuran-2-carboxylic acid. InChIKey: OWFRWTPPOZSWLL-UHFFFAOYSA-N.
| Molecular formula | C9H4F2O3 |
|---|---|
| Molecular weight | 198.12 g/mol |
| IUPAC name | 5,6-difluoro-1-benzofuran-2-carboxylic acid |
| InChIKey | OWFRWTPPOZSWLL-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(OC2=CC(=C1F)F)C(=O)O |
Computed by PubChem (NCBI)