cas: 15599-52-7 — see every product listed under this CAS number, including other names
5,7-Dibromo-2-methylquinolin-8-ol, 97% (CAS 15599-52-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F639936-100MG |
| cas | 15599-52-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 627.92 Pln | |
| Fluorochem | 250mg | 1013.20 Pln | |
| Fluorochem | 1g | 2923.99 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5,7-dibromo-2-methylquinolin-8-ol (CAS 15599-52-7) is a chemical compound with the molecular formula C10H7Br2NO and a molecular weight of 316.98 g/mol. IUPAC name: 5,7-dibromo-2-methylquinolin-8-ol. InChIKey: BNACJQWJZKPAPV-UHFFFAOYSA-N.
| Molecular formula | C10H7Br2NO |
|---|---|
| Molecular weight | 316.98 g/mol |
| IUPAC name | 5,7-dibromo-2-methylquinolin-8-ol |
| InChIKey | BNACJQWJZKPAPV-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C(=CC(=C2O)Br)Br |
Computed by PubChem (NCBI)