CAS 2121598-73-8 is the registry number for 3,6-Dibromo-8-methoxyquinoline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,6-dibromo-8-methoxyquinoline (CAS 2121598-73-8) is a chemical compound with the molecular formula C10H7Br2NO and a molecular weight of 316.98 g/mol. IUPAC name: 3,6-dibromo-8-methoxyquinoline. InChIKey: CCTXVQXYHGDASB-UHFFFAOYSA-N.
| Molecular formula | C10H7Br2NO |
|---|---|
| Molecular weight | 316.98 g/mol |
| IUPAC name | 3,6-dibromo-8-methoxyquinoline |
| InChIKey | CCTXVQXYHGDASB-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC(=C1)Br)C=C(C=N2)Br |
Computed by PubChem (NCBI)