Products 497151-52-7
CAS 497151-52-7 is the registry number for 8-Amino-5,7-dibromonaphthalen-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-amino-5,7-dibromonaphthalen-2-ol (CAS 497151-52-7) is a chemical compound with the molecular formula C10H7Br2NO and a molecular weight of 316.98 g/mol. IUPAC name: 8-amino-5,7-dibromonaphthalen-2-ol. InChIKey: ZQKJUCJYKBQKNQ-UHFFFAOYSA-N.
| Molecular formula | C10H7Br2NO |
|---|---|
| Molecular weight | 316.98 g/mol |
| IUPAC name | 8-amino-5,7-dibromonaphthalen-2-ol |
| InChIKey | ZQKJUCJYKBQKNQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=C(C=C2Br)Br)N |
Computed by PubChem (NCBI)